C31H32N2O5 — CID 11060312
(7E)-7-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-7-phenylheptanoic acid (PubChem CID 11060312) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (7E)-7-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-7-phenylheptanoic acid.
| Compound Name | (7E)-7-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 11060312 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (7E)-7-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-7-phenylheptanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CO/N=C(\CCCCCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O5/c1-23-29(32-31(38-23)26-13-7-3-8-14-26)22-36-27-19-17-24(18-20-27)21-37-33-28(25-11-5-2-6-12-25)15-9-4-10-16-30(34)35/h2-3,5-8,11-14,17-20H,4,9-10,15-16,21-22H2,1H3,(H,34,35)/b33-28+ |
| InChIKey | GXGGOHSUVQOODK-PJJLUWSFSA-N |
| XLogP | 7.19 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|