C32H38N2O3S — CID 18379788
(E)-N-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]-1-phenyldecan-1-imine (PubChem CID 18379788) has the molecular formula C32H38N2O3S and a molecular weight of 530.73 g/mol. Its IUPAC name is (E)-N-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]-1-phenyldecan-1-imine.
| Compound Name | (E)-N-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]-1-phenyldecan-1-imine |
|---|---|
| PubChem CID | 18379788 |
| Molecular Formula | C32H38N2O3S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (E)-N-[[4-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]-1-phenyldecan-1-imine |
| SMILES | CCCCCCCCC/C(=N\OCc1ccc(OCc2nc(-c3cccs3)oc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O3S/c1-3-4-5-6-7-8-12-16-29(27-14-10-9-11-15-27)34-36-23-26-18-20-28(21-19-26)35-24-30-25(2)37-32(33-30)31-17-13-22-38-31/h9-11,13-15,17-22H,3-8,12,16,23-24H2,1-2H3/b34-29+ |
| InChIKey | OXDYHEMWWUVJND-RIHQVDFKSA-N |
| XLogP | 9.35 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|