C32H34N2O5 — CID 54356396
8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoic acid (PubChem CID 54356396) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is 8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoic acid.
| Compound Name | 8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoic acid |
|---|---|
| PubChem CID | 54356396 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CON=C(CCCCCCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O5/c1-24-30(33-32(39-24)27-14-8-5-9-15-27)23-37-28-20-18-25(19-21-28)22-38-34-29(26-12-6-4-7-13-26)16-10-2-3-11-17-31(35)36/h4-9,12-15,18-21H,2-3,10-11,16-17,22-23H2,1H3,(H,35,36) |
| InChIKey | UJJXWXXGGDUKBV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|