C30H29N2O5- — CID 22344559
(6E)-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoate (PubChem CID 22344559) has the molecular formula C30H29N2O5- and a molecular weight of 497.57 g/mol. Its IUPAC name is (6E)-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoate.
| Compound Name | (6E)-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoate |
|---|---|
| PubChem CID | 22344559 |
| Molecular Formula | C30H29N2O5- |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (6E)-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoate |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CO/N=C(\CCCCC(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-22-28(31-30(37-22)25-12-6-3-7-13-25)21-35-26-18-16-23(17-19-26)20-36-32-27(14-8-9-15-29(33)34)24-10-4-2-5-11-24/h2-7,10-13,16-19H,8-9,14-15,20-21H2,1H3,(H,33,34)/p-1/b32-27+ |
| InChIKey | SFIPWOMMPNGXJC-QVAGMWBUSA-M |
| XLogP | 5.46 |
| TPSA | 96.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|