C32H34N2O5 — CID 86589849
(6Z)-2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoic acid (PubChem CID 86589849) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is (6Z)-2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoic acid.
| Compound Name | (6Z)-2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 86589849 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (6Z)-2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-6-phenylhexanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CO/N=C(/CCCC(C)(C)C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O5/c1-23-29(33-30(39-23)26-13-8-5-9-14-26)22-37-27-18-16-24(17-19-27)21-38-34-28(25-11-6-4-7-12-25)15-10-20-32(2,3)31(35)36/h4-9,11-14,16-19H,10,15,20-22H2,1-3H3,(H,35,36)/b34-28- |
| InChIKey | UWFCIGIEADEWGS-BFYITVNDSA-N |
| XLogP | 7.43 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|