C24H26N2O3 — CID 59959752
N-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]hex-4-en-2-imine (PubChem CID 59959752) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]hex-4-en-2-imine.
| Compound Name | N-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]hex-4-en-2-imine |
|---|---|
| PubChem CID | 59959752 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]hex-4-en-2-imine |
| SMILES | CC=CCC(C)=NOCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-4-5-9-18(2)26-28-16-20-12-14-22(15-13-20)27-17-23-19(3)29-24(25-23)21-10-7-6-8-11-21/h4-8,10-15H,9,16-17H2,1-3H3 |
| InChIKey | MHYMXVPOQIYPPG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|