C36H32N2O5 — CID 22344588
ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-[3-(1-phenylethenyl)phenyl]acetate (PubChem CID 22344588) has the molecular formula C36H32N2O5 and a molecular weight of 572.66 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-[3-(1-phenylethenyl)phenyl]acetate.
| Compound Name | ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-[3-(1-phenylethenyl)phenyl]acetate |
|---|---|
| PubChem CID | 22344588 |
| Molecular Formula | C36H32N2O5 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-[3-(1-phenylethenyl)phenyl]acetate |
| SMILES | C=C(c1ccccc1)c1cccc(/C(=N/OCc2ccc(OCc3nc(-c4ccccc4)oc3C)cc2)C(=O)OCC)c1 |
| InChI | InChI=1S/C36H32N2O5/c1-4-40-36(39)34(31-17-11-16-30(22-31)25(2)28-12-7-5-8-13-28)38-42-23-27-18-20-32(21-19-27)41-24-33-26(3)43-35(37-33)29-14-9-6-10-15-29/h5-22H,2,4,23-24H2,1,3H3/b38-34- |
| InChIKey | TVDUZUVJVUTFEJ-RXJYLVDRSA-N |
| XLogP | 7.77 |
| TPSA | 83.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|