C24H18FNO3 — CID 32688963
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 2,2-diphenylacetate (PubChem CID 32688963) has the molecular formula C24H18FNO3 and a molecular weight of 387.41 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 2,2-diphenylacetate.
| Compound Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 32688963 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 2,2-diphenylacetate |
| SMILES | O=C(OCc1coc(-c2ccc(F)cc2)n1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18FNO3/c25-20-13-11-19(12-14-20)23-26-21(15-28-23)16-29-24(27)22(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15,22H,16H2 |
| InChIKey | IFJOXIFHOYJXBA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |