C24H19FN2O5S — CID 55543565
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-(benzylsulfamoyl)benzoate (PubChem CID 55543565) has the molecular formula C24H19FN2O5S and a molecular weight of 466.49 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55543565 |
| Molecular Formula | C24H19FN2O5S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-(benzylsulfamoyl)benzoate |
| SMILES | O=C(OCc1coc(-c2ccc(F)cc2)n1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C24H19FN2O5S/c25-20-11-9-18(10-12-20)23-27-21(15-31-23)16-32-24(28)19-7-4-8-22(13-19)33(29,30)26-14-17-5-2-1-3-6-17/h1-13,15,26H,14,16H2 |
| InChIKey | HLCOTUSRQMJOCO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |