C17H11BrFNO3 — CID 32654742
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-bromobenzoate (PubChem CID 32654742) has the molecular formula C17H11BrFNO3 and a molecular weight of 376.18 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-bromobenzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-bromobenzoate |
|---|---|
| PubChem CID | 32654742 |
| Molecular Formula | C17H11BrFNO3 |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 3-bromobenzoate |
| SMILES | O=C(OCc1coc(-c2ccc(F)cc2)n1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H11BrFNO3/c18-13-3-1-2-12(8-13)17(21)23-10-15-9-22-16(20-15)11-4-6-14(19)7-5-11/h1-9H,10H2 |
| InChIKey | VHTWQOQNBYKMHZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |