C17H11FINO3 — CID 32646400
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 4-iodobenzoate (PubChem CID 32646400) has the molecular formula C17H11FINO3 and a molecular weight of 423.18 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 4-iodobenzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 4-iodobenzoate |
|---|---|
| PubChem CID | 32646400 |
| Molecular Formula | C17H11FINO3 |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl 4-iodobenzoate |
| SMILES | O=C(OCc1coc(-c2ccc(F)cc2)n1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H11FINO3/c18-13-5-1-11(2-6-13)16-20-15(9-22-16)10-23-17(21)12-3-7-14(19)8-4-12/h1-9H,10H2 |
| InChIKey | HMVITHKMSJASCI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|