C17H12FNO3 — CID 58119372
methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]benzoate (PubChem CID 58119372) has the molecular formula C17H12FNO3 and a molecular weight of 297.29 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]benzoate |
|---|---|
| PubChem CID | 58119372 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 4-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2coc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H12FNO3/c1-21-17(20)13-4-2-11(3-5-13)15-10-22-16(19-15)12-6-8-14(18)9-7-12/h2-10H,1H3 |
| InChIKey | UXTUVIJAQMNHPQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |