C15H10ClNO3S — CID 18613894
methyl 4-[4-(5-chlorothiophen-2-yl)-1,3-oxazol-2-yl]benzoate (PubChem CID 18613894) has the molecular formula C15H10ClNO3S and a molecular weight of 319.77 g/mol. Its IUPAC name is methyl 4-[4-(5-chlorothiophen-2-yl)-1,3-oxazol-2-yl]benzoate.
| Compound Name | methyl 4-[4-(5-chlorothiophen-2-yl)-1,3-oxazol-2-yl]benzoate |
|---|---|
| PubChem CID | 18613894 |
| Molecular Formula | C15H10ClNO3S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | methyl 4-[4-(5-chlorothiophen-2-yl)-1,3-oxazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(-c3ccc(Cl)s3)co2)cc1 |
| InChI | InChI=1S/C15H10ClNO3S/c1-19-15(18)10-4-2-9(3-5-10)14-17-11(8-20-14)12-6-7-13(16)21-12/h2-8H,1H3 |
| InChIKey | ZWDBMDZNTYSYCS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |