C8H7ClN2OS — CID 116832484
4-(5-chlorothiophen-2-yl)-N-methyl-1,3-oxazol-2-amine (PubChem CID 116832484) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-methyl-1,3-oxazol-2-amine.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-methyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116832484 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-methyl-1,3-oxazol-2-amine |
| SMILES | CNc1nc(-c2ccc(Cl)s2)co1 |
| InChI | InChI=1S/C8H7ClN2OS/c1-10-8-11-5(4-12-8)6-2-3-7(9)13-6/h2-4H,1H3,(H,10,11) |
| InChIKey | KEYBJCZWOAZIDT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |