C25H16N2O5 — CID 16500587
(2-phenyl-1,3-oxazol-4-yl)methyl 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 16500587) has the molecular formula C25H16N2O5 and a molecular weight of 424.41 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 16500587 |
| Molecular Formula | C25H16N2O5 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(OCc1coc(-c2ccccc2)n1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H16N2O5/c28-23-20-8-4-5-9-21(20)24(29)27(23)19-12-10-17(11-13-19)25(30)32-15-18-14-31-22(26-18)16-6-2-1-3-7-16/h1-14H,15H2 |
| InChIKey | HBDHNCLKEACGJY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|