C24H16N2O6 — CID 42969272
(2-benzamido-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 42969272) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 42969272 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H16N2O6/c27-20(25-21(28)15-6-2-1-3-7-15)14-32-24(31)16-10-12-17(13-11-16)26-22(29)18-8-4-5-9-19(18)23(26)30/h1-13H,14H2,(H,25,27,28) |
| InChIKey | XBDIYUMGKIAPEK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|