C18H16N2O5 — CID 7949820
(2-benzamido-2-oxoethyl) 4-acetamidobenzoate (PubChem CID 7949820) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-acetamidobenzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949820 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O5/c1-12(21)19-15-9-7-14(8-10-15)18(24)25-11-16(22)20-17(23)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | DCYAKCJRWZYERO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |