C18H16ClN3O5 — CID 7949789
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 7949789) has the molecular formula C18H16ClN3O5 and a molecular weight of 389.80 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949789 |
| Molecular Formula | C18H16ClN3O5 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16ClN3O5/c1-11(23)20-15-8-4-13(5-9-15)18(26)27-10-16(24)21-22-17(25)12-2-6-14(19)7-3-12/h2-9H,10H2,1H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | SKJBHVUURWEIGN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|