C16H12Cl2N2O4 — CID 9067593
[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-chlorobenzoate (PubChem CID 9067593) has the molecular formula C16H12Cl2N2O4 and a molecular weight of 367.19 g/mol. Its IUPAC name is [2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 9067593 |
| Molecular Formula | C16H12Cl2N2O4 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O4/c17-11-7-5-10(6-8-11)16(23)24-9-14(21)19-20-15(22)12-3-1-2-4-13(12)18/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | ZMGXZGUNFHGMEJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|