C22H17ClN2O5 — CID 18289074
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 18289074) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 18289074 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(O)cc2)cc1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O5/c23-18-9-5-16(6-10-18)21(28)25-24-20(27)13-30-22(29)17-3-1-14(2-4-17)15-7-11-19(26)12-8-15/h1-12,26H,13H2,(H,24,27)(H,25,28) |
| InChIKey | CHNXZWIMIXEZMW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|