2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate

C21H17ClO3 — CID 22287065

IUPAC2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate
SMILESO=C(OCCc1ccc(Cl)cc1)c1ccc(-c2ccc(O)cc2)cc1
InChIInChI=1S/C21H17ClO3/c22-19-9-1-15(2-10-19)13-14-25-21(24)18-5-3-16(4-6-18)17-7-11-20(23)12-8-17/h1-12,23H,13-14H2
InChIKeyNJEFVVZCFPPUQZ-UHFFFAOYSA-N
MW352.82 g/mol
LogP5.11
Rot. Bonds5

About 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate

2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate (PubChem CID 22287065) has the molecular formula C21H17ClO3 and a molecular weight of 352.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate.

Molecular Properties

Compound Name2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate
PubChem CID22287065
Molecular FormulaC21H17ClO3
Molecular Weight352.82 g/mol
Exact Mass352.09
IUPAC Name2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate
SMILESO=C(OCCc1ccc(Cl)cc1)c1ccc(-c2ccc(O)cc2)cc1
InChIInChI=1S/C21H17ClO3/c22-19-9-1-15(2-10-19)13-14-25-21(24)18-5-3-16(4-6-18)17-7-11-20(23)12-8-17/h1-12,23H,13-14H2
InChIKeyNJEFVVZCFPPUQZ-UHFFFAOYSA-N
XLogP5.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500352.82
LogP ≤ 55.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate?
The IUPAC name of 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate (CID 22287065) is 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate.
What is the SMILES notation for 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate?
The canonical SMILES for 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate is O=C(OCCc1ccc(Cl)cc1)c1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate?
The InChIKey is NJEFVVZCFPPUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClO3/c22-19-9-1-15(2-10-19)13-14-25-21(24)18-5-3-16(4-6-18)17-7-11-20(23)12-8-17/h1-12,23H,13-14H2.
What are the key properties of 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate?
2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate has a molecular weight of 352.82 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)ethyl 4-(4-hydroxyphenyl)benzoate is sourced from PubChem (CID 22287065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).