C34H36O4 — CID 134446759
2-[4-[2-(4-hydroxyphenyl)ethyl]phenyl]ethyl 4-(3-pentoxyphenyl)benzoate (PubChem CID 134446759) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-[4-[2-(4-hydroxyphenyl)ethyl]phenyl]ethyl 4-(3-pentoxyphenyl)benzoate.
| Compound Name | 2-[4-[2-(4-hydroxyphenyl)ethyl]phenyl]ethyl 4-(3-pentoxyphenyl)benzoate |
|---|---|
| PubChem CID | 134446759 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[4-[2-(4-hydroxyphenyl)ethyl]phenyl]ethyl 4-(3-pentoxyphenyl)benzoate |
| SMILES | CCCCCOc1cccc(-c2ccc(C(=O)OCCc3ccc(CCc4ccc(O)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C34H36O4/c1-2-3-4-23-37-33-7-5-6-31(25-33)29-16-18-30(19-17-29)34(36)38-24-22-28-12-10-26(11-13-28)8-9-27-14-20-32(35)21-15-27/h5-7,10-21,25,35H,2-4,8-9,22-24H2,1H3 |
| InChIKey | CYWYLHXCPZPBSJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|