About 4-phenylphenol;propyl 4-hydroxybenzoate
4-phenylphenol;propyl 4-hydroxybenzoate (PubChem CID 174901062) has the molecular formula C22H22O4
and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-phenylphenol;propyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 4-phenylphenol;propyl 4-hydroxybenzoate |
| PubChem CID | 174901062 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-phenylphenol;propyl 4-hydroxybenzoate |
| SMILES | CCCOC(=O)c1ccc(O)cc1.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C10H12O3/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-7-13-10(12)8-3-5-9(11)6-4-8/h1-9,13H;3-6,11H,2,7H2,1H3 |
| InChIKey | WJVDWPXWMFQQFO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenylphenol;propyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylphenol;propyl 4-hydroxybenzoate?
The IUPAC name of 4-phenylphenol;propyl 4-hydroxybenzoate (CID 174901062) is 4-phenylphenol;propyl 4-hydroxybenzoate.
What is the SMILES notation for 4-phenylphenol;propyl 4-hydroxybenzoate?
The canonical SMILES for 4-phenylphenol;propyl 4-hydroxybenzoate is CCCOC(=O)c1ccc(O)cc1.Oc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylphenol;propyl 4-hydroxybenzoate?
The InChIKey is WJVDWPXWMFQQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H12O3/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-7-13-10(12)8-3-5-9(11)6-4-8/h1-9,13H;3-6,11H,2,7H2,1H3.
What are the key properties of 4-phenylphenol;propyl 4-hydroxybenzoate?
4-phenylphenol;propyl 4-hydroxybenzoate has a molecular weight of 350.41 g/mol, XLogP of 5.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylphenol;propyl 4-hydroxybenzoate is sourced from PubChem (CID 174901062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).