About propyl 4-hydroxybenzoate;propyl 2-phenylacetate
propyl 4-hydroxybenzoate;propyl 2-phenylacetate (PubChem CID 174922489) has the molecular formula C21H26O5
and a molecular weight of 358.43 g/mol. Its IUPAC name is propyl 4-hydroxybenzoate;propyl 2-phenylacetate.
Molecular Properties
| Compound Name | propyl 4-hydroxybenzoate;propyl 2-phenylacetate |
| PubChem CID | 174922489 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | propyl 4-hydroxybenzoate;propyl 2-phenylacetate |
| SMILES | CCCOC(=O)Cc1ccccc1.CCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O2.C10H12O3/c1-2-8-13-11(12)9-10-6-4-3-5-7-10;1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-7H,2,8-9H2,1H3;3-6,11H,2,7H2,1H3 |
| InChIKey | LRVZFAFHSOMQIU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 4-hydroxybenzoate;propyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-hydroxybenzoate;propyl 2-phenylacetate?
The IUPAC name of propyl 4-hydroxybenzoate;propyl 2-phenylacetate (CID 174922489) is propyl 4-hydroxybenzoate;propyl 2-phenylacetate.
What is the SMILES notation for propyl 4-hydroxybenzoate;propyl 2-phenylacetate?
The canonical SMILES for propyl 4-hydroxybenzoate;propyl 2-phenylacetate is CCCOC(=O)Cc1ccccc1.CCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of propyl 4-hydroxybenzoate;propyl 2-phenylacetate?
The InChIKey is LRVZFAFHSOMQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C10H12O3/c1-2-8-13-11(12)9-10-6-4-3-5-7-10;1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-7H,2,8-9H2,1H3;3-6,11H,2,7H2,1H3.
What are the key properties of propyl 4-hydroxybenzoate;propyl 2-phenylacetate?
propyl 4-hydroxybenzoate;propyl 2-phenylacetate has a molecular weight of 358.43 g/mol, XLogP of 4.14, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-hydroxybenzoate;propyl 2-phenylacetate is sourced from PubChem (CID 174922489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).