About pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate
pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate (PubChem CID 174491350) has the molecular formula C21H34O5
and a molecular weight of 366.50 g/mol. Its IUPAC name is pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate.
Molecular Properties
| Compound Name | pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate |
| PubChem CID | 174491350 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate |
| SMILES | CC=CCC.CCCOC(=O)CC.CCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O3.C6H12O2.C5H10/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-3-5-8-6(7)4-2;1-3-5-4-2/h3-6,11H,2,7H2,1H3;3-5H2,1-2H3;3,5H,4H2,1-2H3 |
| InChIKey | SEBDDKQDJWTLTQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate?
The IUPAC name of pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate (CID 174491350) is pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate.
What is the SMILES notation for pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate?
The canonical SMILES for pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate is CC=CCC.CCCOC(=O)CC.CCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate?
The InChIKey is SEBDDKQDJWTLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C6H12O2.C5H10/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-3-5-8-6(7)4-2;1-3-5-4-2/h3-6,11H,2,7H2,1H3;3-5H2,1-2H3;3,5H,4H2,1-2H3.
What are the key properties of pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate?
pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate has a molecular weight of 366.50 g/mol, XLogP of 5.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-ene;propyl 4-hydroxybenzoate;propyl propanoate is sourced from PubChem (CID 174491350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).