About 4-methylphenol;propyl propanoate
4-methylphenol;propyl propanoate (PubChem CID 174290139) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-methylphenol;propyl propanoate.
Molecular Properties
| Compound Name | 4-methylphenol;propyl propanoate |
| PubChem CID | 174290139 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-methylphenol;propyl propanoate |
| SMILES | CCCOC(=O)CC.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C6H12O2/c1-6-2-4-7(8)5-3-6;1-3-5-8-6(7)4-2/h2-5,8H,1H3;3-5H2,1-2H3 |
| InChIKey | CVOCCCBJPJKBPO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylphenol;propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;propyl propanoate?
The IUPAC name of 4-methylphenol;propyl propanoate (CID 174290139) is 4-methylphenol;propyl propanoate.
What is the SMILES notation for 4-methylphenol;propyl propanoate?
The canonical SMILES for 4-methylphenol;propyl propanoate is CCCOC(=O)CC.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;propyl propanoate?
The InChIKey is CVOCCCBJPJKBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H12O2/c1-6-2-4-7(8)5-3-6;1-3-5-8-6(7)4-2/h2-5,8H,1H3;3-5H2,1-2H3.
What are the key properties of 4-methylphenol;propyl propanoate?
4-methylphenol;propyl propanoate has a molecular weight of 224.30 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;propyl propanoate is sourced from PubChem (CID 174290139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).