About 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate
2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate (PubChem CID 58446609) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 58446609 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate |
| SMILES | Cc1ccc(CCOC(=O)CCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H20O3/c1-14-2-4-16(5-3-14)12-13-21-18(20)11-8-15-6-9-17(19)10-7-15/h2-7,9-10,19H,8,11-13H2,1H3 |
| InChIKey | KVGIYENVOYOVLC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate?
The IUPAC name of 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate (CID 58446609) is 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate is Cc1ccc(CCOC(=O)CCc2ccc(O)cc2)cc1.
What is the InChIKey of 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate?
The InChIKey is KVGIYENVOYOVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-14-2-4-16(5-3-14)12-13-21-18(20)11-8-15-6-9-17(19)10-7-15/h2-7,9-10,19H,8,11-13H2,1H3.
What are the key properties of 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate?
2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate has a molecular weight of 284.36 g/mol, XLogP of 3.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)ethyl 3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 58446609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).