About 2-(4-hydroxyphenyl)ethyl pentanoate
2-(4-hydroxyphenyl)ethyl pentanoate (PubChem CID 54186146) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl pentanoate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)ethyl pentanoate |
| PubChem CID | 54186146 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl pentanoate |
| SMILES | CCCCC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C13H18O3/c1-2-3-4-13(15)16-10-9-11-5-7-12(14)8-6-11/h5-8,14H,2-4,9-10H2,1H3 |
| InChIKey | PFGBJASSSCYMEK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxyphenyl)ethyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)ethyl pentanoate?
The IUPAC name of 2-(4-hydroxyphenyl)ethyl pentanoate (CID 54186146) is 2-(4-hydroxyphenyl)ethyl pentanoate.
What is the SMILES notation for 2-(4-hydroxyphenyl)ethyl pentanoate?
The canonical SMILES for 2-(4-hydroxyphenyl)ethyl pentanoate is CCCCC(=O)OCCc1ccc(O)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)ethyl pentanoate?
The InChIKey is PFGBJASSSCYMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-2-3-4-13(15)16-10-9-11-5-7-12(14)8-6-11/h5-8,14H,2-4,9-10H2,1H3.
What are the key properties of 2-(4-hydroxyphenyl)ethyl pentanoate?
2-(4-hydroxyphenyl)ethyl pentanoate has a molecular weight of 222.28 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)ethyl pentanoate is sourced from PubChem (CID 54186146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).