About 2-sulfanylethyl 4-chlorobenzoate
2-sulfanylethyl 4-chlorobenzoate (PubChem CID 20559900) has the molecular formula C9H9ClO2S
and a molecular weight of 216.69 g/mol. Its IUPAC name is 2-sulfanylethyl 4-chlorobenzoate.
Molecular Properties
| Compound Name | 2-sulfanylethyl 4-chlorobenzoate |
| PubChem CID | 20559900 |
| Molecular Formula | C9H9ClO2S |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 2-sulfanylethyl 4-chlorobenzoate |
| SMILES | O=C(OCCS)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO2S/c10-8-3-1-7(2-4-8)9(11)12-5-6-13/h1-4,13H,5-6H2 |
| InChIKey | GUWZDDXWRDRUMS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethyl 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethyl 4-chlorobenzoate?
The IUPAC name of 2-sulfanylethyl 4-chlorobenzoate (CID 20559900) is 2-sulfanylethyl 4-chlorobenzoate.
What is the SMILES notation for 2-sulfanylethyl 4-chlorobenzoate?
The canonical SMILES for 2-sulfanylethyl 4-chlorobenzoate is O=C(OCCS)c1ccc(Cl)cc1.
What is the InChIKey of 2-sulfanylethyl 4-chlorobenzoate?
The InChIKey is GUWZDDXWRDRUMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO2S/c10-8-3-1-7(2-4-8)9(11)12-5-6-13/h1-4,13H,5-6H2.
What are the key properties of 2-sulfanylethyl 4-chlorobenzoate?
2-sulfanylethyl 4-chlorobenzoate has a molecular weight of 216.69 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethyl 4-chlorobenzoate is sourced from PubChem (CID 20559900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).