C17H12ClF3N2O4 — CID 7838369
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(trifluoromethyl)benzoate (PubChem CID 7838369) has the molecular formula C17H12ClF3N2O4 and a molecular weight of 400.74 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7838369 |
| Molecular Formula | C17H12ClF3N2O4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C(F)(F)F)cc1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O4/c18-13-7-3-10(4-8-13)15(25)23-22-14(24)9-27-16(26)11-1-5-12(6-2-11)17(19,20)21/h1-8H,9H2,(H,22,24)(H,23,25) |
| InChIKey | LRDWNVSJDMWMSO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|