C16H12ClF3N2O3 — CID 46224736
N-[2-(4-chloroanilino)-2-oxoethoxy]-4-(trifluoromethyl)benzamide (PubChem CID 46224736) has the molecular formula C16H12ClF3N2O3 and a molecular weight of 372.73 g/mol. Its IUPAC name is N-[2-(4-chloroanilino)-2-oxoethoxy]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-chloroanilino)-2-oxoethoxy]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46224736 |
| Molecular Formula | C16H12ClF3N2O3 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[2-(4-chloroanilino)-2-oxoethoxy]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(CONC(=O)c1ccc(C(F)(F)F)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O3/c17-12-5-7-13(8-6-12)21-14(23)9-25-22-15(24)10-1-3-11(4-2-10)16(18,19)20/h1-8H,9H2,(H,21,23)(H,22,24) |
| InChIKey | VDRBZKDWTPWPOW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|