C15H10Cl2F3NO2 — CID 7467602
N-(3,5-dichlorophenyl)-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 7467602) has the molecular formula C15H10Cl2F3NO2 and a molecular weight of 364.15 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7467602 |
| Molecular Formula | C15H10Cl2F3NO2 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2F3NO2/c16-10-5-11(17)7-12(6-10)21-14(22)8-23-13-3-1-9(2-4-13)15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | OCZUKZBPPXYDQC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |