C15H11F3N2O4S — CID 4559758
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 4-(trifluoromethyl)benzoate (PubChem CID 4559758) has the molecular formula C15H11F3N2O4S and a molecular weight of 372.32 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 4559758 |
| Molecular Formula | C15H11F3N2O4S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C(F)(F)F)cc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C15H11F3N2O4S/c16-15(17,18)10-5-3-9(4-6-10)14(23)24-8-12(21)19-20-13(22)11-2-1-7-25-11/h1-7H,8H2,(H,19,21)(H,20,22) |
| InChIKey | XHRKOLOFLJJLAV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|