C14H10Cl2N2O4S — CID 4858613
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2,4-dichlorobenzoate (PubChem CID 4858613) has the molecular formula C14H10Cl2N2O4S and a molecular weight of 373.22 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4858613 |
| Molecular Formula | C14H10Cl2N2O4S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1Cl)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H10Cl2N2O4S/c15-8-3-4-9(10(16)6-8)14(21)22-7-12(19)17-18-13(20)11-2-1-5-23-11/h1-6H,7H2,(H,17,19)(H,18,20) |
| InChIKey | SUYUNJALUCZMDH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|