C8H9N3O4S — CID 175436471
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] carbamate (PubChem CID 175436471) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] carbamate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] carbamate |
|---|---|
| PubChem CID | 175436471 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] carbamate |
| SMILES | NC(=O)OCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C8H9N3O4S/c9-8(14)15-4-6(12)10-11-7(13)5-2-1-3-16-5/h1-3H,4H2,(H2,9,14)(H,10,12)(H,11,13) |
| InChIKey | ZUAAJWSMWKBOFB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|