C14H14N4O4S2 — CID 3715888
1-N',4-N'-bis(thiophene-2-carbonyl)butanedihydrazide (PubChem CID 3715888) has the molecular formula C14H14N4O4S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-N',4-N'-bis(thiophene-2-carbonyl)butanedihydrazide.
| Compound Name | 1-N',4-N'-bis(thiophene-2-carbonyl)butanedihydrazide |
|---|---|
| PubChem CID | 3715888 |
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 1-N',4-N'-bis(thiophene-2-carbonyl)butanedihydrazide |
| SMILES | O=C(CCC(=O)NNC(=O)c1cccs1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H14N4O4S2/c19-11(15-17-13(21)9-3-1-7-23-9)5-6-12(20)16-18-14(22)10-4-2-8-24-10/h1-4,7-8H,5-6H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | CPKSQSQPULFJKF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|