C10H16N2O3S — CID 139072563
N'-(3-methylbutanoyl)thiophene-2-carbohydrazide;hydrate (PubChem CID 139072563) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is N'-(3-methylbutanoyl)thiophene-2-carbohydrazide;hydrate.
| Compound Name | N'-(3-methylbutanoyl)thiophene-2-carbohydrazide;hydrate |
|---|---|
| PubChem CID | 139072563 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | N'-(3-methylbutanoyl)thiophene-2-carbohydrazide;hydrate |
| SMILES | CC(C)CC(=O)NNC(=O)c1cccs1.O |
| InChI | InChI=1S/C10H14N2O2S.H2O/c1-7(2)6-9(13)11-12-10(14)8-4-3-5-15-8;/h3-5,7H,6H2,1-2H3,(H,11,13)(H,12,14);1H2 |
| InChIKey | FERCEUMZRDPJJF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|