C11H16N2O3S2 — CID 66137028
N'-[2-(4-hydroxybutan-2-ylsulfanyl)acetyl]thiophene-2-carbohydrazide (PubChem CID 66137028) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N'-[2-(4-hydroxybutan-2-ylsulfanyl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-hydroxybutan-2-ylsulfanyl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 66137028 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N'-[2-(4-hydroxybutan-2-ylsulfanyl)acetyl]thiophene-2-carbohydrazide |
| SMILES | CC(CCO)SCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-8(4-5-14)18-7-10(15)12-13-11(16)9-3-2-6-17-9/h2-3,6,8,14H,4-5,7H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | LMKDKNGRKROXAM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|