C9H13NO2S — CID 81041290
N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide (PubChem CID 81041290) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 81041290 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(CCO)NC(=O)c1cccs1 |
| InChI | InChI=1S/C9H13NO2S/c1-7(4-5-11)10-9(12)8-3-2-6-13-8/h2-3,6-7,11H,4-5H2,1H3,(H,10,12) |
| InChIKey | PSSZIGJHSUSQIJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |