C8H12N2O2S — CID 82040114
N-(1-aminooxypropan-2-yl)thiophene-2-carboxamide (PubChem CID 82040114) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(1-aminooxypropan-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(1-aminooxypropan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 82040114 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(1-aminooxypropan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(CON)NC(=O)c1cccs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6(5-12-9)10-8(11)7-3-2-4-13-7/h2-4,6H,5,9H2,1H3,(H,10,11) |
| InChIKey | OOGKSCVSXWRIRE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|