C13H20N2O3S — CID 103759054
N-[2-[(1-hydroxy-4-methylpentan-3-yl)amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 103759054) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[2-[(1-hydroxy-4-methylpentan-3-yl)amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(1-hydroxy-4-methylpentan-3-yl)amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103759054 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[2-[(1-hydroxy-4-methylpentan-3-yl)amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CC(C)C(CCO)NC(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H20N2O3S/c1-9(2)10(5-6-16)15-12(17)8-14-13(18)11-4-3-7-19-11/h3-4,7,9-10,16H,5-6,8H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | UXTXERAXILRIGO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |