C19H24N2O2S — CID 9437374
N-[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 9437374) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9437374 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)NC(=O)CNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-13(2)11-15-6-8-16(9-7-15)14(3)21-18(22)12-20-19(23)17-5-4-10-24-17/h4-10,13-14H,11-12H2,1-3H3,(H,20,23)(H,21,22)/t14-/m1/s1 |
| InChIKey | DYYOQTALKSGNMI-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |