C10H16ClN3O2S — CID 120506210
N-[2-[[(2S)-1-aminopropan-2-yl]amino]-2-oxoethyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 120506210) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is N-[2-[[(2S)-1-aminopropan-2-yl]amino]-2-oxoethyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[[(2S)-1-aminopropan-2-yl]amino]-2-oxoethyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120506210 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[2-[[(2S)-1-aminopropan-2-yl]amino]-2-oxoethyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)CNC(=O)c1cccs1.Cl |
| InChI | InChI=1S/C10H15N3O2S.ClH/c1-7(5-11)13-9(14)6-12-10(15)8-3-2-4-16-8;/h2-4,7H,5-6,11H2,1H3,(H,12,15)(H,13,14);1H/t7-;/m0./s1 |
| InChIKey | LKYHVNVBIRGUNQ-FJXQXJEOSA-N |
| XLogP | 0.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |