C13H19NO2S — CID 157304245
N-(3,3,4-trimethyl-2-oxopentyl)thiophene-2-carboxamide (PubChem CID 157304245) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(3,3,4-trimethyl-2-oxopentyl)thiophene-2-carboxamide.
| Compound Name | N-(3,3,4-trimethyl-2-oxopentyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 157304245 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(3,3,4-trimethyl-2-oxopentyl)thiophene-2-carboxamide |
| SMILES | CC(C)C(C)(C)C(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H19NO2S/c1-9(2)13(3,4)11(15)8-14-12(16)10-6-5-7-17-10/h5-7,9H,8H2,1-4H3,(H,14,16) |
| InChIKey | BCGMBFJBIADSOW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |