C12H18BrNOS — CID 107156721
N-(2-bromo-4,4-dimethylpentyl)thiophene-2-carboxamide (PubChem CID 107156721) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)thiophene-2-carboxamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107156721 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)CC(Br)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C12H18BrNOS/c1-12(2,3)7-9(13)8-14-11(15)10-5-4-6-16-10/h4-6,9H,7-8H2,1-3H3,(H,14,15) |
| InChIKey | UDNUZAKLQNPIJQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|