C10H11Br2NO2S — CID 14552701
N-(4,4-dibromo-2-methyl-3-oxobutan-2-yl)thiophene-2-carboxamide (PubChem CID 14552701) has the molecular formula C10H11Br2NO2S and a molecular weight of 369.08 g/mol. Its IUPAC name is N-(4,4-dibromo-2-methyl-3-oxobutan-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(4,4-dibromo-2-methyl-3-oxobutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 14552701 |
| Molecular Formula | C10H11Br2NO2S |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | N-(4,4-dibromo-2-methyl-3-oxobutan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)(NC(=O)c1cccs1)C(=O)C(Br)Br |
| InChI | InChI=1S/C10H11Br2NO2S/c1-10(2,7(14)8(11)12)13-9(15)6-4-3-5-16-6/h3-5,8H,1-2H3,(H,13,15) |
| InChIKey | HJIXOIPQVHBRLT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|