C9H10Cl2N2O2S — CID 108573968
N-[2-[(2,2-dichloroacetyl)amino]ethyl]thiophene-2-carboxamide (PubChem CID 108573968) has the molecular formula C9H10Cl2N2O2S and a molecular weight of 281.16 g/mol. Its IUPAC name is N-[2-[(2,2-dichloroacetyl)amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 108573968 |
| Molecular Formula | C9H10Cl2N2O2S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)C(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C9H10Cl2N2O2S/c10-7(11)9(15)13-4-3-12-8(14)6-2-1-5-16-6/h1-2,5,7H,3-4H2,(H,12,14)(H,13,15) |
| InChIKey | KHACGPHIWSUMFT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|