C9H13NO2S2 — CID 115626836
N-(2-ethylsulfinylethyl)thiophene-2-carboxamide (PubChem CID 115626836) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)thiophene-2-carboxamide.
| Compound Name | N-(2-ethylsulfinylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115626836 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | N-(2-ethylsulfinylethyl)thiophene-2-carboxamide |
| SMILES | CCS(=O)CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C9H13NO2S2/c1-2-14(12)7-5-10-9(11)8-4-3-6-13-8/h3-4,6H,2,5,7H2,1H3,(H,10,11) |
| InChIKey | MEWWRLSEOGEHLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |