C8H11N3O2S — CID 115282462
N-[2-(carbamoylamino)ethyl]thiophene-2-carboxamide (PubChem CID 115282462) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115282462 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]thiophene-2-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C8H11N3O2S/c9-8(13)11-4-3-10-7(12)6-2-1-5-14-6/h1-2,5H,3-4H2,(H,10,12)(H3,9,11,13) |
| InChIKey | BBHKBMQVHXZNIP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|