C13H13N3O2S — CID 108542652
N-[2-(thiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide (PubChem CID 108542652) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[2-(thiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(thiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 108542652 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[2-(thiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccs1)c1ccccn1 |
| InChI | InChI=1S/C13H13N3O2S/c17-12(10-4-1-2-6-14-10)15-7-8-16-13(18)11-5-3-9-19-11/h1-6,9H,7-8H2,(H,15,17)(H,16,18) |
| InChIKey | MJNDABXHOLBFLV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|